C13H14ClN3 — CID 62477691
2-chloro-N-(cyclobutylmethyl)quinazolin-4-amine (PubChem CID 62477691) has the molecular formula C13H14ClN3 and a molecular weight of 247.73 g/mol. Its IUPAC name is 2-chloro-N-(cyclobutylmethyl)quinazolin-4-amine.
| Compound Name | 2-chloro-N-(cyclobutylmethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 62477691 |
| Molecular Formula | C13H14ClN3 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-chloro-N-(cyclobutylmethyl)quinazolin-4-amine |
| SMILES | Clc1nc(NCC2CCC2)c2ccccc2n1 |
| InChI | InChI=1S/C13H14ClN3/c14-13-16-11-7-2-1-6-10(11)12(17-13)15-8-9-4-3-5-9/h1-2,6-7,9H,3-5,8H2,(H,15,16,17) |
| InChIKey | DLKGBQYPILTVEQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |