C13H14ClN3 — CID 62477780
N-benzyl-2-chloro-N,6-dimethylpyrimidin-4-amine (PubChem CID 62477780) has the molecular formula C13H14ClN3 and a molecular weight of 247.73 g/mol. Its IUPAC name is N-benzyl-2-chloro-N,6-dimethylpyrimidin-4-amine.
| Compound Name | N-benzyl-2-chloro-N,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 62477780 |
| Molecular Formula | C13H14ClN3 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-benzyl-2-chloro-N,6-dimethylpyrimidin-4-amine |
| SMILES | Cc1cc(N(C)Cc2ccccc2)nc(Cl)n1 |
| InChI | InChI=1S/C13H14ClN3/c1-10-8-12(16-13(14)15-10)17(2)9-11-6-4-3-5-7-11/h3-8H,9H2,1-2H3 |
| InChIKey | SUHAZLWIPDZRAN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |