C11H13F3N2O3 — CID 62478119
4-methoxy-2-[[3-(trifluoromethyl)-2-pyridinyl]amino]butanoic acid (PubChem CID 62478119) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 4-methoxy-2-[[3-(trifluoromethyl)-2-pyridinyl]amino]butanoic acid.
| Compound Name | 4-methoxy-2-[[3-(trifluoromethyl)-2-pyridinyl]amino]butanoic acid |
|---|---|
| PubChem CID | 62478119 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-methoxy-2-[[3-(trifluoromethyl)-2-pyridinyl]amino]butanoic acid |
| SMILES | COCCC(Nc1ncccc1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H13F3N2O3/c1-19-6-4-8(10(17)18)16-9-7(11(12,13)14)3-2-5-15-9/h2-3,5,8H,4,6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | GFCPKLIFVBCINJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |