C14H20N2O5 — CID 62478128
2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-methoxybutanoic acid (PubChem CID 62478128) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-methoxybutanoic acid.
| Compound Name | 2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 62478128 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C14H20N2O5/c1-21-7-6-12(14(19)20)16-13(18)11(15)8-9-2-4-10(17)5-3-9/h2-5,11-12,17H,6-8,15H2,1H3,(H,16,18)(H,19,20)/t11-,12?/m0/s1 |
| InChIKey | SJSBNRRVNSNYMB-PXYINDEMSA-N |
| XLogP | -0.13 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |