C15H21NO5 — CID 62478591
4-methoxy-2-[3-(2-methylphenoxy)propanoylamino]butanoic acid (PubChem CID 62478591) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is 4-methoxy-2-[3-(2-methylphenoxy)propanoylamino]butanoic acid.
| Compound Name | 4-methoxy-2-[3-(2-methylphenoxy)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 62478591 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 4-methoxy-2-[3-(2-methylphenoxy)propanoylamino]butanoic acid |
| SMILES | COCCC(NC(=O)CCOc1ccccc1C)C(=O)O |
| InChI | InChI=1S/C15H21NO5/c1-11-5-3-4-6-13(11)21-10-8-14(17)16-12(15(18)19)7-9-20-2/h3-6,12H,7-10H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | FPANDDSLVQCPCB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |