About 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid
2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid (PubChem CID 62480182) has the molecular formula C13H19N3O5
and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid.
Molecular Properties
| Compound Name | 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid |
| PubChem CID | 62480182 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)Cc1c(C)nc(=O)[nH]c1C)C(=O)O |
| InChI | InChI=1S/C13H19N3O5/c1-7-9(8(2)15-13(20)14-7)6-11(17)16-10(12(18)19)4-5-21-3/h10H,4-6H2,1-3H3,(H,16,17)(H,18,19)(H,14,15,20) |
| InChIKey | GIFSHTPSYWKRQF-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid?
The IUPAC name of 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid (CID 62480182) is 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid.
What is the SMILES notation for 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid?
The canonical SMILES for 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid is COCCC(NC(=O)Cc1c(C)nc(=O)[nH]c1C)C(=O)O.
What is the InChIKey of 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid?
The InChIKey is GIFSHTPSYWKRQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O5/c1-7-9(8(2)15-13(20)14-7)6-11(17)16-10(12(18)19)4-5-21-3/h10H,4-6H2,1-3H3,(H,16,17)(H,18,19)(H,14,15,20).
What are the key properties of 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid?
2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid has a molecular weight of 297.31 g/mol, XLogP of -0.46, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-4-methoxybutanoic acid is sourced from PubChem (CID 62480182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).