About (3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide
(3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide (PubChem CID 6248026) has the molecular formula C21H25N3O2
and a molecular weight of 351.45 g/mol. Its IUPAC name is (3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide.
Molecular Properties
| Compound Name | (3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide |
| PubChem CID | 6248026 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide |
| SMILES | C/C(CC(=O)NC(C)C)=N\NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O2/c1-15(2)22-19(25)14-16(3)23-24-21(26)20(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,15,20H,14H2,1-3H3,(H,22,25)(H,24,26)/b23-16+ |
| InChIKey | YQCRBTRWKOQIBI-XQNSMLJCSA-N |
| XLogP | 3.23 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide?
The IUPAC name of (3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide (CID 6248026) is (3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide.
What is the SMILES notation for (3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide?
The canonical SMILES for (3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide is C/C(CC(=O)NC(C)C)=N\NC(=O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of (3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide?
The InChIKey is YQCRBTRWKOQIBI-XQNSMLJCSA-N. The full InChI is InChI=1S/C21H25N3O2/c1-15(2)22-19(25)14-16(3)23-24-21(26)20(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,15,20H,14H2,1-3H3,(H,22,25)(H,24,26)/b23-16+.
What are the key properties of (3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide?
(3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide has a molecular weight of 351.45 g/mol, XLogP of 3.23, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(2,2-diphenylacetyl)hydrazinylidene]-N-propan-2-ylbutanamide is sourced from PubChem (CID 6248026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).