About 2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine
2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine (PubChem CID 62481027) has the molecular formula C13H14N4
and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine.
Molecular Properties
| Compound Name | 2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine |
| PubChem CID | 62481027 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine |
| SMILES | Nc1cccc2c1CCN(c1cccnn1)C2 |
| InChI | InChI=1S/C13H14N4/c14-12-4-1-3-10-9-17(8-6-11(10)12)13-5-2-7-15-16-13/h1-5,7H,6,8-9,14H2 |
| InChIKey | AYVVGFXEJZDNQW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine?
The IUPAC name of 2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine (CID 62481027) is 2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine.
What is the SMILES notation for 2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine?
The canonical SMILES for 2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine is Nc1cccc2c1CCN(c1cccnn1)C2.
What is the InChIKey of 2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine?
The InChIKey is AYVVGFXEJZDNQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4/c14-12-4-1-3-10-9-17(8-6-11(10)12)13-5-2-7-15-16-13/h1-5,7H,6,8-9,14H2.
What are the key properties of 2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine?
2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine has a molecular weight of 226.28 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-5-amine is sourced from PubChem (CID 62481027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).