C22H32O2S — CID 6248242
1-methyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylbenzene (PubChem CID 6248242) has the molecular formula C22H32O2S and a molecular weight of 360.56 g/mol. Its IUPAC name is 1-methyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylbenzene.
| Compound Name | 1-methyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylbenzene |
|---|---|
| PubChem CID | 6248242 |
| Molecular Formula | C22H32O2S |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 1-methyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylbenzene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H32O2S/c1-18(2)8-6-9-19(3)10-7-11-20(4)16-17-25(23,24)22-14-12-21(5)13-15-22/h8,10,12-16H,6-7,9,11,17H2,1-5H3/b19-10+,20-16+ |
| InChIKey | IIMOCWXERPQCQP-QZAMUAOBSA-N |
| XLogP | 6.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|