About 4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine
4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine (PubChem CID 62483387) has the molecular formula C10H10Cl2N4
and a molecular weight of 257.12 g/mol. Its IUPAC name is 4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine.
Molecular Properties
| Compound Name | 4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine |
| PubChem CID | 62483387 |
| Molecular Formula | C10H10Cl2N4 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine |
| SMILES | Cc1nc(-c2cc(Cl)cc(Cl)c2)c(N)n1N |
| InChI | InChI=1S/C10H10Cl2N4/c1-5-15-9(10(13)16(5)14)6-2-7(11)4-8(12)3-6/h2-4H,13-14H2,1H3 |
| InChIKey | LMZOZRSTXDWNHC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine?
The IUPAC name of 4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine (CID 62483387) is 4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine.
What is the SMILES notation for 4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine?
The canonical SMILES for 4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine is Cc1nc(-c2cc(Cl)cc(Cl)c2)c(N)n1N.
What is the InChIKey of 4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine?
The InChIKey is LMZOZRSTXDWNHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2N4/c1-5-15-9(10(13)16(5)14)6-2-7(11)4-8(12)3-6/h2-4H,13-14H2,1H3.
What are the key properties of 4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine?
4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine has a molecular weight of 257.12 g/mol, XLogP of 2.46, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dichlorophenyl)-2-methylimidazole-1,5-diamine is sourced from PubChem (CID 62483387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).