About 2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine
2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine (PubChem CID 62483621) has the molecular formula C14H18N4O2
and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine.
Molecular Properties
| Compound Name | 2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine |
| PubChem CID | 62483621 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine |
| SMILES | COc1ccc(-c2nc(C3CC3)n(N)c2N)c(OC)c1 |
| InChI | InChI=1S/C14H18N4O2/c1-19-9-5-6-10(11(7-9)20-2)12-13(15)18(16)14(17-12)8-3-4-8/h5-8H,3-4,15-16H2,1-2H3 |
| InChIKey | BQTAZJYLBJTLCA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine?
The IUPAC name of 2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine (CID 62483621) is 2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine.
What is the SMILES notation for 2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine?
The canonical SMILES for 2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine is COc1ccc(-c2nc(C3CC3)n(N)c2N)c(OC)c1.
What is the InChIKey of 2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine?
The InChIKey is BQTAZJYLBJTLCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2/c1-19-9-5-6-10(11(7-9)20-2)12-13(15)18(16)14(17-12)8-3-4-8/h5-8H,3-4,15-16H2,1-2H3.
What are the key properties of 2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine?
2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine has a molecular weight of 274.32 g/mol, XLogP of 1.74, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-4-(2,4-dimethoxyphenyl)imidazole-1,5-diamine is sourced from PubChem (CID 62483621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).