C11H10Cl2N2OS — CID 62484343
[4-[(3,4-dichlorophenoxy)methyl]-1,3-thiazol-2-yl]methanamine (PubChem CID 62484343) has the molecular formula C11H10Cl2N2OS and a molecular weight of 289.19 g/mol. Its IUPAC name is [4-[(3,4-dichlorophenoxy)methyl]-1,3-thiazol-2-yl]methanamine.
| Compound Name | [4-[(3,4-dichlorophenoxy)methyl]-1,3-thiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 62484343 |
| Molecular Formula | C11H10Cl2N2OS |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | [4-[(3,4-dichlorophenoxy)methyl]-1,3-thiazol-2-yl]methanamine |
| SMILES | NCc1nc(COc2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C11H10Cl2N2OS/c12-9-2-1-8(3-10(9)13)16-5-7-6-17-11(4-14)15-7/h1-3,6H,4-5,14H2 |
| InChIKey | XXPUANORKCIXPN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |