C15H16INO2 — CID 62484968
N-[[5-[(3-iodophenoxy)methyl]furan-2-yl]methyl]cyclopropanamine (PubChem CID 62484968) has the molecular formula C15H16INO2 and a molecular weight of 369.20 g/mol. Its IUPAC name is N-[[5-[(3-iodophenoxy)methyl]furan-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-[(3-iodophenoxy)methyl]furan-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62484968 |
| Molecular Formula | C15H16INO2 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | N-[[5-[(3-iodophenoxy)methyl]furan-2-yl]methyl]cyclopropanamine |
| SMILES | Ic1cccc(OCc2ccc(CNC3CC3)o2)c1 |
| InChI | InChI=1S/C15H16INO2/c16-11-2-1-3-13(8-11)18-10-15-7-6-14(19-15)9-17-12-4-5-12/h1-3,6-8,12,17H,4-5,9-10H2 |
| InChIKey | RAWUJXJKNPCDSS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|