C19H19N7 — CID 6248528
3-N-[(Z)-(6-ethyl-2-phenylindolizin-3-yl)methylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 6248528) has the molecular formula C19H19N7 and a molecular weight of 345.41 g/mol. Its IUPAC name is 3-N-[(Z)-(6-ethyl-2-phenylindolizin-3-yl)methylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(Z)-(6-ethyl-2-phenylindolizin-3-yl)methylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 6248528 |
| Molecular Formula | C19H19N7 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-N-[(Z)-(6-ethyl-2-phenylindolizin-3-yl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | CCc1ccc2cc(-c3ccccc3)c(/C=N\Nc3nncn3N)n2c1 |
| InChI | InChI=1S/C19H19N7/c1-2-14-8-9-16-10-17(15-6-4-3-5-7-15)18(25(16)12-14)11-21-23-19-24-22-13-26(19)20/h3-13H,2,20H2,1H3,(H,23,24)/b21-11- |
| InChIKey | NYIACWCNPVVCQO-NHDPSOOVSA-N |
| XLogP | 2.92 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|