C14H24N2O — CID 62485408
N,N-dimethyl-3-[1-(propylamino)propan-2-yloxy]aniline (PubChem CID 62485408) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N,N-dimethyl-3-[1-(propylamino)propan-2-yloxy]aniline.
| Compound Name | N,N-dimethyl-3-[1-(propylamino)propan-2-yloxy]aniline |
|---|---|
| PubChem CID | 62485408 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N,N-dimethyl-3-[1-(propylamino)propan-2-yloxy]aniline |
| SMILES | CCCNCC(C)Oc1cccc(N(C)C)c1 |
| InChI | InChI=1S/C14H24N2O/c1-5-9-15-11-12(2)17-14-8-6-7-13(10-14)16(3)4/h6-8,10,12,15H,5,9,11H2,1-4H3 |
| InChIKey | XSYMKPXXLPGUIN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|