C13H17BrClNO — CID 62485655
N-[4-(4-bromo-2-chlorophenoxy)butyl]cyclopropanamine (PubChem CID 62485655) has the molecular formula C13H17BrClNO and a molecular weight of 318.64 g/mol. Its IUPAC name is N-[4-(4-bromo-2-chlorophenoxy)butyl]cyclopropanamine.
| Compound Name | N-[4-(4-bromo-2-chlorophenoxy)butyl]cyclopropanamine |
|---|---|
| PubChem CID | 62485655 |
| Molecular Formula | C13H17BrClNO |
| Molecular Weight | 318.64 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | N-[4-(4-bromo-2-chlorophenoxy)butyl]cyclopropanamine |
| SMILES | Clc1cc(Br)ccc1OCCCCNC1CC1 |
| InChI | InChI=1S/C13H17BrClNO/c14-10-3-6-13(12(15)9-10)17-8-2-1-7-16-11-4-5-11/h3,6,9,11,16H,1-2,4-5,7-8H2 |
| InChIKey | BFKGXSIMVUHSAC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|