C12H16FNO2 — CID 62487925
2-(2-fluoroanilino)-2,3-dimethylbutanoic acid (PubChem CID 62487925) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 2-(2-fluoroanilino)-2,3-dimethylbutanoic acid.
| Compound Name | 2-(2-fluoroanilino)-2,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 62487925 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-(2-fluoroanilino)-2,3-dimethylbutanoic acid |
| SMILES | CC(C)C(C)(Nc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C12H16FNO2/c1-8(2)12(3,11(15)16)14-10-7-5-4-6-9(10)13/h4-8,14H,1-3H3,(H,15,16) |
| InChIKey | KQTGMFPMDSOZQR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |