C13H18N2O4S — CID 62488191
2-phenyl-2-(pyrrolidin-1-ylsulfonylamino)propanoic acid (PubChem CID 62488191) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-phenyl-2-(pyrrolidin-1-ylsulfonylamino)propanoic acid.
| Compound Name | 2-phenyl-2-(pyrrolidin-1-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 62488191 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-phenyl-2-(pyrrolidin-1-ylsulfonylamino)propanoic acid |
| SMILES | CC(NS(=O)(=O)N1CCCC1)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H18N2O4S/c1-13(12(16)17,11-7-3-2-4-8-11)14-20(18,19)15-9-5-6-10-15/h2-4,7-8,14H,5-6,9-10H2,1H3,(H,16,17) |
| InChIKey | WGLBDUXCKNPYMZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |