C19H22N2O3 — CID 624899
N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-methylacetamide (PubChem CID 624899) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-methylacetamide.
| Compound Name | N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 624899 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-methylacetamide |
| SMILES | CC(=O)N(C)C1=C(N2CCCCCC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H22N2O3/c1-13(22)20(2)16-17(21-11-7-3-4-8-12-21)19(24)15-10-6-5-9-14(15)18(16)23/h5-6,9-10H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | HDXKFSSHTXIUAF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|