About 2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole
2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole (PubChem CID 6249017) has the molecular formula C18H15F2NOS
and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole |
| PubChem CID | 6249017 |
| Molecular Formula | C18H15F2NOS |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole |
| SMILES | Cc1cc2nc(/C=C/c3ccccc3OC(F)F)sc2cc1C |
| InChI | InChI=1S/C18H15F2NOS/c1-11-9-14-16(10-12(11)2)23-17(21-14)8-7-13-5-3-4-6-15(13)22-18(19)20/h3-10,18H,1-2H3/b8-7+ |
| InChIKey | LSVOIEBQWGQPNB-BQYQJAHWSA-N |
| XLogP | 5.68 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole?
The IUPAC name of 2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole (CID 6249017) is 2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole.
What is the SMILES notation for 2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole?
The canonical SMILES for 2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole is Cc1cc2nc(/C=C/c3ccccc3OC(F)F)sc2cc1C.
What is the InChIKey of 2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole?
The InChIKey is LSVOIEBQWGQPNB-BQYQJAHWSA-N. The full InChI is InChI=1S/C18H15F2NOS/c1-11-9-14-16(10-12(11)2)23-17(21-14)8-7-13-5-3-4-6-15(13)22-18(19)20/h3-10,18H,1-2H3/b8-7+.
What are the key properties of 2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole?
2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole has a molecular weight of 331.39 g/mol, XLogP of 5.68, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-[2-(difluoromethoxy)phenyl]ethenyl]-5,6-dimethyl-1,3-benzothiazole is sourced from PubChem (CID 6249017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).