C9H14F3NO — CID 62490949
1-(3-ethylpiperidin-1-yl)-2,2,2-trifluoroethanone (PubChem CID 62490949) has the molecular formula C9H14F3NO and a molecular weight of 209.21 g/mol. Its IUPAC name is 1-(3-ethylpiperidin-1-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(3-ethylpiperidin-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 62490949 |
| Molecular Formula | C9H14F3NO |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1-(3-ethylpiperidin-1-yl)-2,2,2-trifluoroethanone |
| SMILES | CCC1CCCN(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H14F3NO/c1-2-7-4-3-5-13(6-7)8(14)9(10,11)12/h7H,2-6H2,1H3 |
| InChIKey | QCJWKHADJSYPJK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |