C10H8Cl2F3NO — CID 62491259
N-[2-(2,4-dichlorophenyl)ethyl]-2,2,2-trifluoroacetamide (PubChem CID 62491259) has the molecular formula C10H8Cl2F3NO and a molecular weight of 286.08 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 62491259 |
| Molecular Formula | C10H8Cl2F3NO |
| Molecular Weight | 286.08 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C10H8Cl2F3NO/c11-7-2-1-6(8(12)5-7)3-4-16-9(17)10(13,14)15/h1-2,5H,3-4H2,(H,16,17) |
| InChIKey | VEPPWJCXQBXVIS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.08 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |