C11H16F3NO — CID 62491614
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2,2-trifluoroethanone (PubChem CID 62491614) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 62491614 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCCC2CCCCC21)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO/c12-11(13,14)10(16)15-7-3-5-8-4-1-2-6-9(8)15/h8-9H,1-7H2 |
| InChIKey | MAWPTHSOUMYTBJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |