C11H10F3NO2 — CID 62491972
N-(3,4-dihydro-2H-chromen-4-yl)-2,2,2-trifluoroacetamide (PubChem CID 62491972) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 62491972 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(NC1CCOc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO2/c12-11(13,14)10(16)15-8-5-6-17-9-4-2-1-3-7(8)9/h1-4,8H,5-6H2,(H,15,16) |
| InChIKey | SALDBVDJGUFUAV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |