C14H19ClN2OS — CID 62493326
5-chloro-2-[2-(2-hydroxyethyl)piperidin-1-yl]benzenecarbothioamide (PubChem CID 62493326) has the molecular formula C14H19ClN2OS and a molecular weight of 298.84 g/mol. Its IUPAC name is 5-chloro-2-[2-(2-hydroxyethyl)piperidin-1-yl]benzenecarbothioamide.
| Compound Name | 5-chloro-2-[2-(2-hydroxyethyl)piperidin-1-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 62493326 |
| Molecular Formula | C14H19ClN2OS |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-chloro-2-[2-(2-hydroxyethyl)piperidin-1-yl]benzenecarbothioamide |
| SMILES | NC(=S)c1cc(Cl)ccc1N1CCCCC1CCO |
| InChI | InChI=1S/C14H19ClN2OS/c15-10-4-5-13(12(9-10)14(16)19)17-7-2-1-3-11(17)6-8-18/h4-5,9,11,18H,1-3,6-8H2,(H2,16,19) |
| InChIKey | WUUBIFAKQRCAGQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|