C13H17N3 — CID 62497089
2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]aniline (PubChem CID 62497089) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]aniline.
| Compound Name | 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]aniline |
|---|---|
| PubChem CID | 62497089 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]aniline |
| SMILES | Cc1cc(C)n(CCc2ccccc2N)n1 |
| InChI | InChI=1S/C13H17N3/c1-10-9-11(2)16(15-10)8-7-12-5-3-4-6-13(12)14/h3-6,9H,7-8,14H2,1-2H3 |
| InChIKey | HSSRSIJTJSAXBR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|