About 2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol
2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol (PubChem CID 62498952) has the molecular formula C8H12N6O2
and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol |
| PubChem CID | 62498952 |
| Molecular Formula | C8H12N6O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol |
| SMILES | OCCOCCNc1cncc2nnnn12 |
| InChI | InChI=1S/C8H12N6O2/c15-2-4-16-3-1-10-7-5-9-6-8-11-12-13-14(7)8/h5-6,10,15H,1-4H2 |
| InChIKey | KFMURAYOJNEVFG-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol?
The IUPAC name of 2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol (CID 62498952) is 2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol.
What is the SMILES notation for 2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol?
The canonical SMILES for 2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol is OCCOCCNc1cncc2nnnn12.
What is the InChIKey of 2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol?
The InChIKey is KFMURAYOJNEVFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6O2/c15-2-4-16-3-1-10-7-5-9-6-8-11-12-13-14(7)8/h5-6,10,15H,1-4H2.
What are the key properties of 2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol?
2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol has a molecular weight of 224.22 g/mol, XLogP of -1.06, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(tetrazolo[1,5-a]pyrazin-5-ylamino)ethoxy]ethanol is sourced from PubChem (CID 62498952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).