C18H26N2O — CID 62499999
2-(3-aminophenyl)-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide (PubChem CID 62499999) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-(3-aminophenyl)-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide.
| Compound Name | 2-(3-aminophenyl)-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide |
|---|---|
| PubChem CID | 62499999 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 2-(3-aminophenyl)-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide |
| SMILES | CC1(C)C2CCC1(C)C(NC(=O)Cc1cccc(N)c1)C2 |
| InChI | InChI=1S/C18H26N2O/c1-17(2)13-7-8-18(17,3)15(11-13)20-16(21)10-12-5-4-6-14(19)9-12/h4-6,9,13,15H,7-8,10-11,19H2,1-3H3,(H,20,21) |
| InChIKey | KJGBQCLJZARNIQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|