C12H17ClN2S — CID 62500759
2-[butyl(methyl)amino]-6-chlorobenzenecarbothioamide (PubChem CID 62500759) has the molecular formula C12H17ClN2S and a molecular weight of 256.80 g/mol. Its IUPAC name is 2-[butyl(methyl)amino]-6-chlorobenzenecarbothioamide.
| Compound Name | 2-[butyl(methyl)amino]-6-chlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 62500759 |
| Molecular Formula | C12H17ClN2S |
| Molecular Weight | 256.80 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-[butyl(methyl)amino]-6-chlorobenzenecarbothioamide |
| SMILES | CCCCN(C)c1cccc(Cl)c1C(N)=S |
| InChI | InChI=1S/C12H17ClN2S/c1-3-4-8-15(2)10-7-5-6-9(13)11(10)12(14)16/h5-7H,3-4,8H2,1-2H3,(H2,14,16) |
| InChIKey | CZLUFEAPOPYEEA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.80 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|