C17H19NO — CID 62500963
6-(4-methoxy-3-methylphenyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 62500963) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 6-(4-methoxy-3-methylphenyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-(4-methoxy-3-methylphenyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 62500963 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 6-(4-methoxy-3-methylphenyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1ccc(-c2ccc3c(c2)CCCN3)cc1C |
| InChI | InChI=1S/C17H19NO/c1-12-10-13(6-8-17(12)19-2)14-5-7-16-15(11-14)4-3-9-18-16/h5-8,10-11,18H,3-4,9H2,1-2H3 |
| InChIKey | OHYWIPSUCAPKEZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |