C11H7BrN2O2S — CID 62501048
3-(5-bromofuran-2-yl)-4-thiophen-2-yl-1,2-oxazol-5-amine (PubChem CID 62501048) has the molecular formula C11H7BrN2O2S and a molecular weight of 311.16 g/mol. Its IUPAC name is 3-(5-bromofuran-2-yl)-4-thiophen-2-yl-1,2-oxazol-5-amine.
| Compound Name | 3-(5-bromofuran-2-yl)-4-thiophen-2-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 62501048 |
| Molecular Formula | C11H7BrN2O2S |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 309.94 |
| IUPAC Name | 3-(5-bromofuran-2-yl)-4-thiophen-2-yl-1,2-oxazol-5-amine |
| SMILES | Nc1onc(-c2ccc(Br)o2)c1-c1cccs1 |
| InChI | InChI=1S/C11H7BrN2O2S/c12-8-4-3-6(15-8)10-9(11(13)16-14-10)7-2-1-5-17-7/h1-5H,13H2 |
| InChIKey | ZWCPCLHPZLZNCV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |