About 3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile
3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile (PubChem CID 62501566) has the molecular formula C15H12N2OS2
and a molecular weight of 300.41 g/mol. Its IUPAC name is 3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile |
| PubChem CID | 62501566 |
| Molecular Formula | C15H12N2OS2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile |
| SMILES | Cc1cc(-c2sc(C#N)c(N)c2-c2cccs2)c(C)o1 |
| InChI | InChI=1S/C15H12N2OS2/c1-8-6-10(9(2)18-8)15-13(11-4-3-5-19-11)14(17)12(7-16)20-15/h3-6H,17H2,1-2H3 |
| InChIKey | RJTPUCAWUNRBTB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile?
The IUPAC name of 3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile (CID 62501566) is 3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile.
What is the SMILES notation for 3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile?
The canonical SMILES for 3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile is Cc1cc(-c2sc(C#N)c(N)c2-c2cccs2)c(C)o1.
What is the InChIKey of 3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile?
The InChIKey is RJTPUCAWUNRBTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2OS2/c1-8-6-10(9(2)18-8)15-13(11-4-3-5-19-11)14(17)12(7-16)20-15/h3-6H,17H2,1-2H3.
What are the key properties of 3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile?
3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile has a molecular weight of 300.41 g/mol, XLogP of 4.81, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(2,5-dimethylfuran-3-yl)-4-thiophen-2-ylthiophene-2-carbonitrile is sourced from PubChem (CID 62501566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).