C18H16O7 — CID 6250403
3,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 6250403) has the molecular formula C18H16O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is 3,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 3,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 6250403 |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(-c2oc3cc(O)ccc3c(=O)c2O)cc(OC)c1OC |
| InChI | InChI=1S/C18H16O7/c1-22-13-6-9(7-14(23-2)18(13)24-3)17-16(21)15(20)11-5-4-10(19)8-12(11)25-17/h4-8,19,21H,1-3H3 |
| InChIKey | NJNGYVOYOVPWBB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |