C16H15ClN2O2 — CID 62504109
2-[(3-chlorophenyl)methyl]-5,6-dimethoxy-1H-benzimidazole (PubChem CID 62504109) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-5,6-dimethoxy-1H-benzimidazole.
| Compound Name | 2-[(3-chlorophenyl)methyl]-5,6-dimethoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 62504109 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-5,6-dimethoxy-1H-benzimidazole |
| SMILES | COc1cc2nc(Cc3cccc(Cl)c3)[nH]c2cc1OC |
| InChI | InChI=1S/C16H15ClN2O2/c1-20-14-8-12-13(9-15(14)21-2)19-16(18-12)7-10-4-3-5-11(17)6-10/h3-6,8-9H,7H2,1-2H3,(H,18,19) |
| InChIKey | KWASLAMEQMMUAI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |