(2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone

C15H12F2O2 — CID 62504204

IUPAC(2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone
SMILESCOc1ccc(C)cc1C(=O)c1cc(F)ccc1F
InChIInChI=1S/C15H12F2O2/c1-9-3-6-14(19-2)12(7-9)15(18)11-8-10(16)4-5-13(11)17/h3-8H,1-2H3
InChIKeySRZDAVKEIMHJDI-UHFFFAOYSA-N
MW262.25 g/mol
LogP3.51
Rot. Bonds3

About (2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone

(2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone (PubChem CID 62504204) has the molecular formula C15H12F2O2 and a molecular weight of 262.25 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone.

Molecular Properties

Compound Name(2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone
PubChem CID62504204
Molecular FormulaC15H12F2O2
Molecular Weight262.25 g/mol
Exact Mass262.08
IUPAC Name(2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone
SMILESCOc1ccc(C)cc1C(=O)c1cc(F)ccc1F
InChIInChI=1S/C15H12F2O2/c1-9-3-6-14(19-2)12(7-9)15(18)11-8-10(16)4-5-13(11)17/h3-8H,1-2H3
InChIKeySRZDAVKEIMHJDI-UHFFFAOYSA-N
XLogP3.51
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.25
LogP ≤ 53.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(5-chloro-2-methoxyphenyl)-(5-fluoro-2-methoxyphenyl)methanone
CID 43339633
(2,5-difluorophenyl)-(2,5-dimethylphenyl)methanone
CID 43337442
(5-fluoro-2-methoxyphenyl)-(2,3,4-trifluorophenyl)methanone
CID 56980668
(5-fluoro-2-methoxyphenyl)-(4-fluoro-3-methylphenyl)methanone
CID 63209421
(5-chloro-2-methoxyphenyl)-(4-fluoro-2-methylphenyl)methanone
CID 81274056
(2-bromo-5-fluorophenyl)-(5-chloro-2-methoxyphenyl)methanone
CID 104544915
(2-bromo-4-fluorophenyl)-(2-fluoro-5-methylphenyl)methanone
CID 114970853
(2-bromo-4-fluorophenyl)-(5-fluoro-2-methoxyphenyl)methanone
CID 43339651
(2,4-dimethoxyphenyl)-(5-fluoro-2-methoxyphenyl)methanone
CID 43339638
(4-bromo-2-methylphenyl)-(5-fluoro-2-methoxyphenyl)methanone
CID 43629665
(5-bromo-2-fluorophenyl)-(2-methoxy-4-methylphenyl)methanone
CID 106790410
[4-(2,4-difluoroanilino)phenyl]-(2-methoxy-5-methylphenyl)methanone
CID 142171196

Frequently Asked Questions

What is the IUPAC name of (2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone?
The IUPAC name of (2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone (CID 62504204) is (2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone.
What is the SMILES notation for (2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone?
The canonical SMILES for (2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone is COc1ccc(C)cc1C(=O)c1cc(F)ccc1F.
What is the InChIKey of (2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone?
The InChIKey is SRZDAVKEIMHJDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2O2/c1-9-3-6-14(19-2)12(7-9)15(18)11-8-10(16)4-5-13(11)17/h3-8H,1-2H3.
What are the key properties of (2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone?
(2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone has a molecular weight of 262.25 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-difluorophenyl)-(2-methoxy-5-methylphenyl)methanone is sourced from PubChem (CID 62504204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).