About 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine
2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine (PubChem CID 62504517) has the molecular formula C12H25NO2S
and a molecular weight of 247.40 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine |
| PubChem CID | 62504517 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine |
| SMILES | CC(C)(C)CCC(CN)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H25NO2S/c1-12(2,3)6-4-10(8-13)11-5-7-16(14,15)9-11/h10-11H,4-9,13H2,1-3H3 |
| InChIKey | HZUOBYBMRHGXIM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine (CID 62504517) is 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine is CC(C)(C)CCC(CN)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine?
The InChIKey is HZUOBYBMRHGXIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2S/c1-12(2,3)6-4-10(8-13)11-5-7-16(14,15)9-11/h10-11H,4-9,13H2,1-3H3.
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine?
2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine has a molecular weight of 247.40 g/mol, XLogP of 1.82, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-5,5-dimethylhexan-1-amine is sourced from PubChem (CID 62504517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).