C24H24ClN3O6 — CID 6250534
(4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(3-morpholin-4-ylpropyl)-5-(4-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 6250534) has the molecular formula C24H24ClN3O6 and a molecular weight of 485.92 g/mol. Its IUPAC name is (4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(3-morpholin-4-ylpropyl)-5-(4-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(3-morpholin-4-ylpropyl)-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6250534 |
| Molecular Formula | C24H24ClN3O6 |
| Molecular Weight | 485.92 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | (4Z)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(3-morpholin-4-ylpropyl)-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCCN2CCOCC2)C(c2ccc([N+](=O)[O-])cc2)/C1=C(/O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24ClN3O6/c25-18-6-2-17(3-7-18)22(29)20-21(16-4-8-19(9-5-16)28(32)33)27(24(31)23(20)30)11-1-10-26-12-14-34-15-13-26/h2-9,21,29H,1,10-15H2/b22-20- |
| InChIKey | LVDFRZNUWMJELU-XDOYNYLZSA-N |
| XLogP | 3.39 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.92 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|