C27H34N2O6 — CID 6250698
4-[(3E)-1-[2-(diethylazaniumyl)ethyl]-3-[hydroxy-(4-methoxy-2-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]-2-ethoxyphenolate (PubChem CID 6250698) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is 4-[(3E)-1-[2-(diethylazaniumyl)ethyl]-3-[hydroxy-(4-methoxy-2-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]-2-ethoxyphenolate.
| Compound Name | 4-[(3E)-1-[2-(diethylazaniumyl)ethyl]-3-[hydroxy-(4-methoxy-2-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]-2-ethoxyphenolate |
|---|---|
| PubChem CID | 6250698 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 4-[(3E)-1-[2-(diethylazaniumyl)ethyl]-3-[hydroxy-(4-methoxy-2-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]-2-ethoxyphenolate |
| SMILES | CCOc1cc(C2/C(=C(\O)c3ccc(OC)cc3C)C(=O)C(=O)N2CC[NH+](CC)CC)ccc1[O-] |
| InChI | InChI=1S/C27H34N2O6/c1-6-28(7-2)13-14-29-24(18-9-12-21(30)22(16-18)35-8-3)23(26(32)27(29)33)25(31)20-11-10-19(34-5)15-17(20)4/h9-12,15-16,24,30-31H,6-8,13-14H2,1-5H3/b25-23+ |
| InChIKey | HOVWHWDAROQYEB-WJTDDFOZSA-N |
| XLogP | 1.82 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|