C14H14N2O3 — CID 62507482
2-(3,4-dimethylphenoxy)-5-nitroaniline (PubChem CID 62507482) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-5-nitroaniline.
| Compound Name | 2-(3,4-dimethylphenoxy)-5-nitroaniline |
|---|---|
| PubChem CID | 62507482 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-5-nitroaniline |
| SMILES | Cc1ccc(Oc2ccc([N+](=O)[O-])cc2N)cc1C |
| InChI | InChI=1S/C14H14N2O3/c1-9-3-5-12(7-10(9)2)19-14-6-4-11(16(17)18)8-13(14)15/h3-8H,15H2,1-2H3 |
| InChIKey | WJVBTTMUXDLPPW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|