About 4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine
4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine (PubChem CID 62508601) has the molecular formula C14H20N4
and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine.
Molecular Properties
| Compound Name | 4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine |
| PubChem CID | 62508601 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine |
| SMILES | Cc1cccc(-c2nc(C(C)C)n(N)c2N)c1C |
| InChI | InChI=1S/C14H20N4/c1-8(2)14-17-12(13(15)18(14)16)11-7-5-6-9(3)10(11)4/h5-8H,15-16H2,1-4H3 |
| InChIKey | YQTSJIVKZDMGAA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine?
The IUPAC name of 4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine (CID 62508601) is 4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine.
What is the SMILES notation for 4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine?
The canonical SMILES for 4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine is Cc1cccc(-c2nc(C(C)C)n(N)c2N)c1C.
What is the InChIKey of 4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine?
The InChIKey is YQTSJIVKZDMGAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4/c1-8(2)14-17-12(13(15)18(14)16)11-7-5-6-9(3)10(11)4/h5-8H,15-16H2,1-4H3.
What are the key properties of 4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine?
4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine has a molecular weight of 244.34 g/mol, XLogP of 2.59, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylphenyl)-2-propan-2-ylimidazole-1,5-diamine is sourced from PubChem (CID 62508601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).