C17H18FNO2 — CID 62509266
2-fluoro-N-(3-methoxy-2,4-dimethylphenyl)-5-methylbenzamide (PubChem CID 62509266) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is 2-fluoro-N-(3-methoxy-2,4-dimethylphenyl)-5-methylbenzamide.
| Compound Name | 2-fluoro-N-(3-methoxy-2,4-dimethylphenyl)-5-methylbenzamide |
|---|---|
| PubChem CID | 62509266 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-fluoro-N-(3-methoxy-2,4-dimethylphenyl)-5-methylbenzamide |
| SMILES | COc1c(C)ccc(NC(=O)c2cc(C)ccc2F)c1C |
| InChI | InChI=1S/C17H18FNO2/c1-10-5-7-14(18)13(9-10)17(20)19-15-8-6-11(2)16(21-4)12(15)3/h5-9H,1-4H3,(H,19,20) |
| InChIKey | IFAAYLQWZUUWLR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |