C18H26N2O — CID 62510099
N-(dicyclopropylmethyl)-5-methyl-2-(propylamino)benzamide (PubChem CID 62510099) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-5-methyl-2-(propylamino)benzamide.
| Compound Name | N-(dicyclopropylmethyl)-5-methyl-2-(propylamino)benzamide |
|---|---|
| PubChem CID | 62510099 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-(dicyclopropylmethyl)-5-methyl-2-(propylamino)benzamide |
| SMILES | CCCNc1ccc(C)cc1C(=O)NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C18H26N2O/c1-3-10-19-16-9-4-12(2)11-15(16)18(21)20-17(13-5-6-13)14-7-8-14/h4,9,11,13-14,17,19H,3,5-8,10H2,1-2H3,(H,20,21) |
| InChIKey | JZORPEFWELVPIZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |