C17H22N2O2 — CID 62510582
N-[2-(furan-2-yl)ethyl]-5-methyl-2-(propylamino)benzamide (PubChem CID 62510582) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-5-methyl-2-(propylamino)benzamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-5-methyl-2-(propylamino)benzamide |
|---|---|
| PubChem CID | 62510582 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-5-methyl-2-(propylamino)benzamide |
| SMILES | CCCNc1ccc(C)cc1C(=O)NCCc1ccco1 |
| InChI | InChI=1S/C17H22N2O2/c1-3-9-18-16-7-6-13(2)12-15(16)17(20)19-10-8-14-5-4-11-21-14/h4-7,11-12,18H,3,8-10H2,1-2H3,(H,19,20) |
| InChIKey | MEAKEYNCYVEMMR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |