C15H23ClN2 — CID 62511752
N-[[1-(4-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]propan-2-amine (PubChem CID 62511752) has the molecular formula C15H23ClN2 and a molecular weight of 266.82 g/mol. Its IUPAC name is N-[[1-(4-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-(4-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 62511752 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N-[[1-(4-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]propan-2-amine |
| SMILES | Cc1cc(Cl)ccc1N1CCC(CNC(C)C)C1 |
| InChI | InChI=1S/C15H23ClN2/c1-11(2)17-9-13-6-7-18(10-13)15-5-4-14(16)8-12(15)3/h4-5,8,11,13,17H,6-7,9-10H2,1-3H3 |
| InChIKey | DENHZKFLKVSBEU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |