C18H28N2 — CID 62512550
N-[[1-(2,3-dihydro-1H-inden-5-yl)pyrrolidin-3-yl]methyl]-2-methylpropan-1-amine (PubChem CID 62512550) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N-[[1-(2,3-dihydro-1H-inden-5-yl)pyrrolidin-3-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-(2,3-dihydro-1H-inden-5-yl)pyrrolidin-3-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 62512550 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N-[[1-(2,3-dihydro-1H-inden-5-yl)pyrrolidin-3-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC1CCN(c2ccc3c(c2)CCC3)C1 |
| InChI | InChI=1S/C18H28N2/c1-14(2)11-19-12-15-8-9-20(13-15)18-7-6-16-4-3-5-17(16)10-18/h6-7,10,14-15,19H,3-5,8-9,11-13H2,1-2H3 |
| InChIKey | BMXGXBYOWXZIRT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|