C15H20F4N2 — CID 62513094
N-[[1-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methyl]propan-1-amine (PubChem CID 62513094) has the molecular formula C15H20F4N2 and a molecular weight of 304.33 g/mol. Its IUPAC name is N-[[1-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62513094 |
| Molecular Formula | C15H20F4N2 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-[[1-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCN(c2ccc(F)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H20F4N2/c1-2-6-20-9-11-5-7-21(10-11)12-3-4-14(16)13(8-12)15(17,18)19/h3-4,8,11,20H,2,5-7,9-10H2,1H3 |
| InChIKey | LNIKSRRSKXXDPQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|