About (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide
(10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide (PubChem CID 625135) has the molecular formula C18H12N4
and a molecular weight of 284.32 g/mol. Its IUPAC name is (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide.
Molecular Properties
| Compound Name | (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide |
| PubChem CID | 625135 |
| Molecular Formula | C18H12N4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide |
| SMILES | Cc1cc2c(cc1C)/C(=N/C#N)c1ccccc1/C2=N\C#N |
| InChI | InChI=1S/C18H12N4/c1-11-7-15-16(8-12(11)2)18(22-10-20)14-6-4-3-5-13(14)17(15)21-9-19/h3-8H,1-2H3/b21-17+,22-18+ |
| InChIKey | OSHYODJQTSZUFU-KSTNYAOJSA-N |
| XLogP | 3.25 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide?
The IUPAC name of (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide (CID 625135) is (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide.
What is the SMILES notation for (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide?
The canonical SMILES for (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide is Cc1cc2c(cc1C)/C(=N/C#N)c1ccccc1/C2=N\C#N.
What is the InChIKey of (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide?
The InChIKey is OSHYODJQTSZUFU-KSTNYAOJSA-N. The full InChI is InChI=1S/C18H12N4/c1-11-7-15-16(8-12(11)2)18(22-10-20)14-6-4-3-5-13(14)17(15)21-9-19/h3-8H,1-2H3/b21-17+,22-18+.
What are the key properties of (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide?
(10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide has a molecular weight of 284.32 g/mol, XLogP of 3.25, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide is sourced from PubChem (CID 625135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).