C18H12N4 — CID 625135
(10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide (PubChem CID 625135) has the molecular formula C18H12N4 and a molecular weight of 284.32 g/mol. Its IUPAC name is (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide.
| Compound Name | (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide |
|---|---|
| PubChem CID | 625135 |
| Molecular Formula | C18H12N4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (10-cyanoimino-2,3-dimethylanthracen-9-ylidene)cyanamide |
| SMILES | Cc1cc2c(cc1C)/C(=N/C#N)c1ccccc1/C2=N\C#N |
| InChI | InChI=1S/C18H12N4/c1-11-7-15-16(8-12(11)2)18(22-10-20)14-6-4-3-5-13(14)17(15)21-9-19/h3-8H,1-2H3/b21-17+,22-18+ |
| InChIKey | OSHYODJQTSZUFU-KSTNYAOJSA-N |
| XLogP | 3.25 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|