C15H17NO3 — CID 62515703
5-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]benzoic acid (PubChem CID 62515703) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 5-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]benzoic acid.
| Compound Name | 5-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 62515703 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 5-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]benzoic acid |
| SMILES | Cc1ccc(N(C)Cc2ccoc2C)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H17NO3/c1-10-4-5-14(13(8-10)15(17)18)16(3)9-12-6-7-19-11(12)2/h4-8H,9H2,1-3H3,(H,17,18) |
| InChIKey | JTKXKHNHOVFKIZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |