C17H19ClFNS — CID 62516083
N-[2-[(5-chlorothiophen-2-yl)methyl]-3-(4-fluorophenyl)propyl]cyclopropanamine (PubChem CID 62516083) has the molecular formula C17H19ClFNS and a molecular weight of 323.86 g/mol. Its IUPAC name is N-[2-[(5-chlorothiophen-2-yl)methyl]-3-(4-fluorophenyl)propyl]cyclopropanamine.
| Compound Name | N-[2-[(5-chlorothiophen-2-yl)methyl]-3-(4-fluorophenyl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 62516083 |
| Molecular Formula | C17H19ClFNS |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[2-[(5-chlorothiophen-2-yl)methyl]-3-(4-fluorophenyl)propyl]cyclopropanamine |
| SMILES | Fc1ccc(CC(CNC2CC2)Cc2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C17H19ClFNS/c18-17-8-7-16(21-17)10-13(11-20-15-5-6-15)9-12-1-3-14(19)4-2-12/h1-4,7-8,13,15,20H,5-6,9-11H2 |
| InChIKey | SFDJJOJGYZXLGM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |