C18H13BrClNO2S2 — CID 6251665
(5Z)-3-(4-bromophenyl)-5-[(5-chloro-2-ethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6251665) has the molecular formula C18H13BrClNO2S2 and a molecular weight of 454.80 g/mol. Its IUPAC name is (5Z)-3-(4-bromophenyl)-5-[(5-chloro-2-ethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(4-bromophenyl)-5-[(5-chloro-2-ethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6251665 |
| Molecular Formula | C18H13BrClNO2S2 |
| Molecular Weight | 454.80 g/mol |
| Exact Mass | 452.93 |
| IUPAC Name | (5Z)-3-(4-bromophenyl)-5-[(5-chloro-2-ethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(Cl)cc1/C=C1\SC(=S)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C18H13BrClNO2S2/c1-2-23-15-8-5-13(20)9-11(15)10-16-17(22)21(18(24)25-16)14-6-3-12(19)4-7-14/h3-10H,2H2,1H3/b16-10- |
| InChIKey | FEOXDZJQSCHDGD-YBEGLDIGSA-N |
| XLogP | 5.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.80 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|